C19H22BNO6 — CID 23834775
(3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-5-(methoxymethyl)-2-methyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione (PubChem CID 23834775) has the molecular formula C19H22BNO6 and a molecular weight of 371.20 g/mol. Its IUPAC name is (3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-5-(methoxymethyl)-2-methyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-5-(methoxymethyl)-2-methyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23834775 |
| Molecular Formula | C19H22BNO6 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3aS,8S,9aS,9bR)-6-hydroxy-8-(3-hydroxyphenyl)-5-(methoxymethyl)-2-methyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-1,3-dione |
| SMILES | COCC1=C2B(O)O[C@H](c3cccc(O)c3)C[C@H]2[C@H]2C(=O)N(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C19H22BNO6/c1-21-18(23)14-7-11(9-26-2)17-13(16(14)19(21)24)8-15(27-20(17)25)10-4-3-5-12(22)6-10/h3-6,13-16,22,25H,7-9H2,1-2H3/t13-,14-,15-,16+/m0/s1 |
| InChIKey | GDKFCUQGVFXCLM-YHUYYLMFSA-N |
| XLogP | 1.07 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|