C25H23BClNO8 — CID 23834800
methyl (3aS,8S,9aS,9bR)-8-(2-chloro-4-hydroxyphenyl)-6-hydroxy-1,3-dioxo-5-(phenoxymethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-2-carboxylate (PubChem CID 23834800) has the molecular formula C25H23BClNO8 and a molecular weight of 511.72 g/mol. Its IUPAC name is methyl (3aS,8S,9aS,9bR)-8-(2-chloro-4-hydroxyphenyl)-6-hydroxy-1,3-dioxo-5-(phenoxymethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,8S,9aS,9bR)-8-(2-chloro-4-hydroxyphenyl)-6-hydroxy-1,3-dioxo-5-(phenoxymethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 23834800 |
| Molecular Formula | C25H23BClNO8 |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | methyl (3aS,8S,9aS,9bR)-8-(2-chloro-4-hydroxyphenyl)-6-hydroxy-1,3-dioxo-5-(phenoxymethyl)-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC(COc3ccccc3)=C3B(O)O[C@H](c4ccc(O)cc4Cl)C[C@H]32)C1=O |
| InChI | InChI=1S/C25H23BClNO8/c1-34-25(32)28-23(30)18-9-13(12-35-15-5-3-2-4-6-15)22-17(21(18)24(28)31)11-20(36-26(22)33)16-8-7-14(29)10-19(16)27/h2-8,10,17-18,20-21,29,33H,9,11-12H2,1H3/t17-,18-,20-,21+/m0/s1 |
| InChIKey | HGYNIUHUZHDRCZ-JYAXBFRTSA-N |
| XLogP | 3.29 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|