C25H25NO8 — CID 23834816
methyl (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-(phenoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate (PubChem CID 23834816) has the molecular formula C25H25NO8 and a molecular weight of 467.47 g/mol. Its IUPAC name is methyl (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-(phenoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-(phenoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 23834816 |
| Molecular Formula | C25H25NO8 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | methyl (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-(phenoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](C[C@H](COc3ccccc3)[C@@]3(O)O[C@H](c4cccc(O)c4)C[C@@H]23)C1=O |
| InChI | InChI=1S/C25H25NO8/c1-32-24(30)26-22(28)18-11-15(13-33-17-8-3-2-4-9-17)25(31)19(21(18)23(26)29)12-20(34-25)14-6-5-7-16(27)10-14/h2-10,15,18-21,27,31H,11-13H2,1H3/t15-,18+,19+,20+,21+,25-/m1/s1 |
| InChIKey | AAVFSHGKETUBDS-MPNCPCASSA-N |
| XLogP | 2.62 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|