C26H23F6NO6 — CID 23863129
(3aS,5R,5aS,7S,8aS,8bR)-2-[3,5-bis(trifluoromethyl)phenyl]-5a-hydroxy-7-(4-hydroxyphenyl)-5-(methoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23863129) has the molecular formula C26H23F6NO6 and a molecular weight of 559.46 g/mol. Its IUPAC name is (3aS,5R,5aS,7S,8aS,8bR)-2-[3,5-bis(trifluoromethyl)phenyl]-5a-hydroxy-7-(4-hydroxyphenyl)-5-(methoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5R,5aS,7S,8aS,8bR)-2-[3,5-bis(trifluoromethyl)phenyl]-5a-hydroxy-7-(4-hydroxyphenyl)-5-(methoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23863129 |
| Molecular Formula | C26H23F6NO6 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | (3aS,5R,5aS,7S,8aS,8bR)-2-[3,5-bis(trifluoromethyl)phenyl]-5a-hydroxy-7-(4-hydroxyphenyl)-5-(methoxymethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | COC[C@H]1C[C@@H]2C(=O)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(O)cc3)O[C@]12O |
| InChI | InChI=1S/C26H23F6NO6/c1-38-11-15-9-18-21(19-10-20(39-24(15,19)37)12-2-4-17(34)5-3-12)23(36)33(22(18)35)16-7-13(25(27,28)29)6-14(8-16)26(30,31)32/h2-8,15,18-21,34,37H,9-11H2,1H3/t15-,18+,19+,20+,21+,24-/m1/s1 |
| InChIKey | MTJVFIPBHOGQTN-NYSOPJTISA-N |
| XLogP | 4.67 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|