C23H24BNO8 — CID 23890996
[3-[(3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 23890996) has the molecular formula C23H24BNO8 and a molecular weight of 453.26 g/mol. Its IUPAC name is [3-[(3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23890996 |
| Molecular Formula | C23H24BNO8 |
| Molecular Weight | 453.26 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | [3-[(3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-5-(hydroxymethyl)-7-(2-hydroxyphenyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1[C@H]2[C@H](C[C@H](CO)[C@@]3(O)O[C@H](c4ccccc4O)C[C@@H]23)C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C23H24BNO8/c26-11-12-8-16-20(17-10-19(33-23(12,17)30)15-6-1-2-7-18(15)27)22(29)25(21(16)28)14-5-3-4-13(9-14)24(31)32/h1-7,9,12,16-17,19-20,26-27,30-32H,8,10-11H2/t12-,16+,17+,19+,20+,23-/m1/s1 |
| InChIKey | VDSKYFBPBJUWNQ-DJYSFWMOSA-N |
| XLogP | -0.34 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|