C24H25BBrNO8 — CID 23776990
[3-[(3aS,5R,5aS,7S,8aS,8bR)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-(methoxymethyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 23776990) has the molecular formula C24H25BBrNO8 and a molecular weight of 546.18 g/mol. Its IUPAC name is [3-[(3aS,5R,5aS,7S,8aS,8bR)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-(methoxymethyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,5R,5aS,7S,8aS,8bR)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-(methoxymethyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23776990 |
| Molecular Formula | C24H25BBrNO8 |
| Molecular Weight | 546.18 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | [3-[(3aS,5R,5aS,7S,8aS,8bR)-7-(5-bromo-2-hydroxyphenyl)-5a-hydroxy-5-(methoxymethyl)-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | COC[C@H]1C[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3cc(Br)ccc3O)O[C@]12O |
| InChI | InChI=1S/C24H25BBrNO8/c1-34-11-12-7-17-21(23(30)27(22(17)29)15-4-2-3-13(8-15)25(32)33)18-10-20(35-24(12,18)31)16-9-14(26)5-6-19(16)28/h2-6,8-9,12,17-18,20-21,28,31-33H,7,10-11H2,1H3/t12-,17+,18+,20+,21+,24-/m1/s1 |
| InChIKey | ZNMQJFSZNSCELE-UJAVVFGWSA-N |
| XLogP | 1.07 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|