C24H25BFNO7 — CID 23975016
[3-[(3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 23975016) has the molecular formula C24H25BFNO7 and a molecular weight of 469.27 g/mol. Its IUPAC name is [3-[(3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23975016 |
| Molecular Formula | C24H25BFNO7 |
| Molecular Weight | 469.27 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [3-[(3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | CC[C@H]1C[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(O)c(F)c3)O[C@]12O |
| InChI | InChI=1S/C24H25BFNO7/c1-2-13-9-16-21(23(30)27(22(16)29)15-5-3-4-14(10-15)25(32)33)17-11-20(34-24(13,17)31)12-6-7-19(28)18(26)8-12/h3-8,10,13,16-17,20-21,28,31-33H,2,9,11H2,1H3/t13-,16-,17-,20-,21-,24+/m0/s1 |
| InChIKey | BDTPJPUXABKXSM-QPDRTNIHSA-N |
| XLogP | 1.21 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|