C21H24FNO7 — CID 23863163
methyl (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate (PubChem CID 23863163) has the molecular formula C21H24FNO7 and a molecular weight of 421.42 g/mol. Its IUPAC name is methyl (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 23863163 |
| Molecular Formula | C21H24FNO7 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | methyl (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate |
| SMILES | CCC[C@H]1C[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(O)c(F)c3)O[C@]12O |
| InChI | InChI=1S/C21H24FNO7/c1-3-4-11-8-12-17(19(26)23(18(12)25)20(27)29-2)13-9-16(30-21(11,13)28)10-5-6-15(24)14(22)7-10/h5-7,11-13,16-17,24,28H,3-4,8-9H2,1-2H3/t11-,12-,13-,16-,17-,21+/m0/s1 |
| InChIKey | VNWSBHNOFGOVEU-SXSMZCMCSA-N |
| XLogP | 2.49 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|