C27H37NO7 — CID 23891008
6-[(3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]hexanoic acid (PubChem CID 23891008) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is 6-[(3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23891008 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 6-[(3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]hexanoic acid |
| SMILES | CCC[C@H]1C[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2[C@@H]2C[C@@H](c3cc(C)c(O)c(C)c3)O[C@]12O |
| InChI | InChI=1S/C27H37NO7/c1-4-8-18-13-19-23(26(33)28(25(19)32)10-7-5-6-9-22(29)30)20-14-21(35-27(18,20)34)17-11-15(2)24(31)16(3)12-17/h11-12,18-21,23,31,34H,4-10,13-14H2,1-3H3,(H,29,30)/t18-,19-,20-,21-,23-,27+/m0/s1 |
| InChIKey | ZJDITKSAKHEOBV-LBWBLAEESA-N |
| XLogP | 3.84 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|