C27H36BNO7 — CID 23834793
6-[(3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 23834793) has the molecular formula C27H36BNO7 and a molecular weight of 497.40 g/mol. Its IUPAC name is 6-[(3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23834793 |
| Molecular Formula | C27H36BNO7 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 6-[(3aS,8S,9aS,9bR)-6-hydroxy-8-(4-hydroxy-3,5-dimethylphenyl)-1,3-dioxo-5-propyl-3a,4,8,9,9a,9b-hexahydrooxaborinino[4,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | CCCC1=C2B(O)O[C@H](c3cc(C)c(O)c(C)c3)C[C@H]2[C@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C27H36BNO7/c1-4-8-17-13-20-23(27(34)29(26(20)33)10-7-5-6-9-22(30)31)19-14-21(36-28(35)24(17)19)18-11-15(2)25(32)16(3)12-18/h11-12,19-21,23,32,35H,4-10,13-14H2,1-3H3,(H,30,31)/t19-,20-,21-,23+/m0/s1 |
| InChIKey | HNEYEHNILHYDLW-VVSUKSJXSA-N |
| XLogP | 3.85 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|