C23H23BClNO7 — CID 23919022
[3-[(3aS,5S,5aR,7S,8aS,8bR)-7-(2-chloro-4-hydroxyphenyl)-5a-hydroxy-5-methyl-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 23919022) has the molecular formula C23H23BClNO7 and a molecular weight of 471.70 g/mol. Its IUPAC name is [3-[(3aS,5S,5aR,7S,8aS,8bR)-7-(2-chloro-4-hydroxyphenyl)-5a-hydroxy-5-methyl-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,5S,5aR,7S,8aS,8bR)-7-(2-chloro-4-hydroxyphenyl)-5a-hydroxy-5-methyl-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23919022 |
| Molecular Formula | C23H23BClNO7 |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [3-[(3aS,5S,5aR,7S,8aS,8bR)-7-(2-chloro-4-hydroxyphenyl)-5a-hydroxy-5-methyl-1,3-dioxo-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | C[C@H]1C[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(O)cc3Cl)O[C@]12O |
| InChI | InChI=1S/C23H23BClNO7/c1-11-7-16-20(22(29)26(21(16)28)13-4-2-3-12(8-13)24(31)32)17-10-19(33-23(11,17)30)15-6-5-14(27)9-18(15)25/h2-6,8-9,11,16-17,19-20,27,30-32H,7,10H2,1H3/t11-,16-,17-,19-,20-,23+/m0/s1 |
| InChIKey | RYOIMQALXCQXFX-YSSNENNASA-N |
| XLogP | 1.34 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|