C23H24N2O8 — CID 23863142
(3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-2-(3-nitrophenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23863142) has the molecular formula C23H24N2O8 and a molecular weight of 456.45 g/mol. Its IUPAC name is (3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-2-(3-nitrophenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-2-(3-nitrophenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23863142 |
| Molecular Formula | C23H24N2O8 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (3aS,5S,5aR,7S,8aS,8bR)-5-ethyl-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-2-(3-nitrophenyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | CC[C@H]1C[C@@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(CO)o3)O[C@]12O |
| InChI | InChI=1S/C23H24N2O8/c1-2-12-8-16-20(17-10-19(33-23(12,17)29)18-7-6-15(11-26)32-18)22(28)24(21(16)27)13-4-3-5-14(9-13)25(30)31/h3-7,9,12,16-17,19-20,26,29H,2,8,10-11H2,1H3/t12-,16-,17-,19-,20-,23+/m0/s1 |
| InChIKey | ZQZHXZOVXQGKHR-CICZXDARSA-N |
| XLogP | 2.68 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|