C16H21NO5S-2 — CID 2374956
(2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbutanedioate (PubChem CID 2374956) has the molecular formula C16H21NO5S-2 and a molecular weight of 339.41 g/mol. Its IUPAC name is (2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbutanedioate.
| Compound Name | (2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbutanedioate |
|---|---|
| PubChem CID | 2374956 |
| Molecular Formula | C16H21NO5S-2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbutanedioate |
| SMILES | O=C([O-])C[C@H](SCC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)[O-] |
| InChI | InChI=1S/C16H23NO5S/c18-13(8-23-12(15(21)22)4-14(19)20)17-16-5-9-1-10(6-16)3-11(2-9)7-16/h9-12H,1-8H2,(H,17,18)(H,19,20)(H,21,22)/p-2/t9?,10?,11?,12-,16?/m0/s1 |
| InChIKey | SFILBOFYNKWDFV-UHUJKFBGSA-L |
| XLogP | -0.94 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |