C15H22NO3S- — CID 7673600
(2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 7673600) has the molecular formula C15H22NO3S- and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | (2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 7673600 |
| Molecular Formula | C15H22NO3S- |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S)-2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | C[C@H](SCC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)[O-] |
| InChI | InChI=1S/C15H23NO3S/c1-9(14(18)19)20-8-13(17)16-15-5-10-2-11(6-15)4-12(3-10)7-15/h9-12H,2-8H2,1H3,(H,16,17)(H,18,19)/p-1/t9-,10?,11?,12?,15?/m0/s1 |
| InChIKey | NHFDIQULGGVZHH-RXOVYUGGSA-M |
| XLogP | 0.94 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |