C34H42N2O6 — CID 23752023
pent-4-enyl (5R,6R,7R)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23752023) has the molecular formula C34H42N2O6 and a molecular weight of 574.72 g/mol. Its IUPAC name is pent-4-enyl (5R,6R,7R)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6R,7R)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23752023 |
| Molecular Formula | C34H42N2O6 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | pent-4-enyl (5R,6R,7R)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC[C@H]1O3 |
| InChI | InChI=1S/C34H42N2O6/c1-5-8-11-19-41-33(40)28-27-16-17-34(42-27)29(28)31(38)36(26(21-37)22(4)7-3)30(34)32(39)35(18-6-2)25-15-14-23-12-9-10-13-24(23)20-25/h5-6,9-10,12-15,20,22,26-30,37H,1-2,7-8,11,16-19,21H2,3-4H3/t22-,26-,27+,28-,29-,30?,34?/m0/s1 |
| InChIKey | AWFDRHJHDOWRKH-UISDQCPZSA-N |
| XLogP | 4.65 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|