C31H42N2O7 — CID 23781354
pent-4-enyl (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23781354) has the molecular formula C31H42N2O7 and a molecular weight of 554.68 g/mol. Its IUPAC name is pent-4-enyl (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23781354 |
| Molecular Formula | C31H42N2O7 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | pent-4-enyl (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)c2ccc(OC)cc2)N([C@@H](CO)[C@@H](C)CC)C(=O)[C@H]13 |
| InChI | InChI=1S/C31H42N2O7/c1-6-9-10-18-39-30(37)25-24-15-16-31(40-24)26(25)28(35)33(23(19-34)20(4)8-3)27(31)29(36)32(17-7-2)21-11-13-22(38-5)14-12-21/h6-7,11-14,20,23-27,34H,1-2,8-10,15-19H2,3-5H3/t20-,23-,24-,25+,26-,27?,31?/m0/s1 |
| InChIKey | FISWZWAVUKTCFM-WQYCIEGXSA-N |
| XLogP | 3.51 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|