C21H23NOS — CID 2375399
(3E)-1-benzylsulfanyl-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 2375399) has the molecular formula C21H23NOS and a molecular weight of 337.49 g/mol. Its IUPAC name is (3E)-1-benzylsulfanyl-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3E)-1-benzylsulfanyl-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 2375399 |
| Molecular Formula | C21H23NOS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3E)-1-benzylsulfanyl-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C/C(=O)CSCc2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H23NOS/c1-21(2)18-11-7-8-12-19(18)22(3)20(21)13-17(23)15-24-14-16-9-5-4-6-10-16/h4-13H,14-15H2,1-3H3/b20-13+ |
| InChIKey | DWVLSNRPJRPVGF-DEDYPNTBSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|