C24H32ClN3O4S — CID 23754313
(5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754313) has the molecular formula C24H32ClN3O4S and a molecular weight of 494.06 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754313 |
| Molecular Formula | C24H32ClN3O4S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)C(C)C)C(C(=O)Nc3c(C)cccc3Cl)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C24H32ClN3O4S/c1-12(2)15(11-29)28-19(21(31)27-18-13(3)7-6-8-14(18)25)24-10-9-23(4,33-24)16(20(30)26-5)17(24)22(28)32/h6-8,12,15-17,19,29H,9-11H2,1-5H3,(H,26,30)(H,27,31)/t15-,16-,17-,19?,23+,24?/m0/s1 |
| InChIKey | BRUKNPRDKVKCMR-FSSJPRFGSA-N |
| XLogP | 2.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |