C28H38N2O6 — CID 23756307
ethyl (1R,2R,5S,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23756307) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23756307 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)[C@@H]1N([C@H](CO)c2ccccc2)C(=O)[C@H]2[C@H](C(=O)OCC)[C@@H]3CC[C@]12O3)C(C)CCC |
| InChI | InChI=1S/C28H38N2O6/c1-5-11-18(4)29(16-6-2)26(33)24-28-15-14-21(36-28)22(27(34)35-7-3)23(28)25(32)30(24)20(17-31)19-12-9-8-10-13-19/h6,8-10,12-13,18,20-24,31H,2,5,7,11,14-17H2,1,3-4H3/t18?,20-,21+,22-,23-,24+,28-/m1/s1 |
| InChIKey | KUSKFEIXVZWNDP-GGRAIQJOSA-N |
| XLogP | 2.86 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|