C37H47N3O6 — CID 23753541
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23753541) has the molecular formula C37H47N3O6 and a molecular weight of 629.80 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23753541 |
| Molecular Formula | C37H47N3O6 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)C(C)CCC)N([C@H](CO)c2ccccc2)C(=O)[C@H]13)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C37H47N3O6/c1-6-13-25(5)38(22-7-2)36(44)33-37-21-20-30(46-37)31(32(37)35(43)40(33)29(24-41)26-14-11-10-12-15-26)34(42)39(23-8-3)27-16-18-28(19-17-27)45-9-4/h7-8,10-12,14-19,25,29-33,41H,2-3,6,9,13,20-24H2,1,4-5H3/t25?,29-,30+,31-,32+,33?,37?/m1/s1 |
| InChIKey | AFUKCIJVMWKCNM-DHBYYYRISA-N |
| XLogP | 4.92 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|