C36H36ClN3O5 — CID 23868638
(5R,6S,7S)-2-N-(2-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868638) has the molecular formula C36H36ClN3O5 and a molecular weight of 626.15 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868638 |
| Molecular Formula | C36H36ClN3O5 |
| Molecular Weight | 626.15 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)c2ccccc2Cl)N([C@H](CO)c2ccccc2)C(=O)[C@H]13)c1ccccc1 |
| InChI | InChI=1S/C36H36ClN3O5/c1-3-21-38(25-15-9-6-10-16-25)33(42)30-29-19-20-36(45-29)31(30)34(43)40(28(23-41)24-13-7-5-8-14-24)32(36)35(44)39(22-4-2)27-18-12-11-17-26(27)37/h3-18,28-32,41H,1-2,19-23H2/t28-,29+,30-,31+,32?,36?/m1/s1 |
| InChIKey | YWLPMOTUINIESE-CKCHVDIASA-N |
| XLogP | 5.19 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.15 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|