C38H47N3O6 — CID 23980375
(5R,6S,7S)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980375) has the molecular formula C38H47N3O6 and a molecular weight of 641.81 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980375 |
| Molecular Formula | C38H47N3O6 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | (5R,6S,7S)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)C2CCCCC2)N([C@H](CO)c2ccccc2)C(=O)[C@H]13)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C38H47N3O6/c1-4-23-39(28-17-19-29(20-18-28)46-6-3)35(43)32-31-21-22-38(47-31)33(32)36(44)41(30(25-42)26-13-9-7-10-14-26)34(38)37(45)40(24-5-2)27-15-11-8-12-16-27/h4-5,7,9-10,13-14,17-20,27,30-34,42H,1-2,6,8,11-12,15-16,21-25H2,3H3/t30-,31+,32-,33+,34?,38?/m1/s1 |
| InChIKey | QVYARFYAFYOFLN-FFDGGDJTSA-N |
| XLogP | 5.06 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|