C27H27ClN2O6 — CID 23843506
(1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23843506) has the molecular formula C27H27ClN2O6 and a molecular weight of 510.97 g/mol. Its IUPAC name is (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23843506 |
| Molecular Formula | C27H27ClN2O6 |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)[C@@H]1N([C@H](CO)c2ccccc2)C(=O)[C@H]2[C@H](C(=O)O)[C@@H]3CC[C@]12O3)c1ccccc1Cl |
| InChI | InChI=1S/C27H27ClN2O6/c1-2-14-29(18-11-7-6-10-17(18)28)25(33)23-27-13-12-20(36-27)21(26(34)35)22(27)24(32)30(23)19(15-31)16-8-4-3-5-9-16/h2-11,19-23,31H,1,12-15H2,(H,34,35)/t19-,20+,21-,22-,23+,27-/m1/s1 |
| InChIKey | KHXDWDUWTJVWDE-WOKOPJFQSA-N |
| XLogP | 3.05 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|