C34H39N5O5Si — CID 23757464
N-[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23757464) has the molecular formula C34H39N5O5Si and a molecular weight of 625.80 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23757464 |
| Molecular Formula | C34H39N5O5Si |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@]12C(=O)N(C)c1ccc(NC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C34H39N5O5Si/c1-22-31(45(3,4)43)30(17-18-39-20-28(36-37-39)26(21-40)23-11-7-5-8-12-23)44-34(22)27-19-25(15-16-29(27)38(2)33(34)42)35-32(41)24-13-9-6-10-14-24/h5-16,19-20,22,26,30-31,40,43H,17-18,21H2,1-4H3,(H,35,41)/t22-,26?,30+,31-,34+/m0/s1 |
| InChIKey | APAIZNKAFHVHBP-GSRQMJEISA-N |
| XLogP | 4.52 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|