C28H35FN4O4Si — CID 23956408
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23956408) has the molecular formula C28H35FN4O4Si and a molecular weight of 538.70 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23956408 |
| Molecular Formula | C28H35FN4O4Si |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc2c(c1)[C@]1(O[C@@H](CCn3cc(C(CO)c4ccccc4)nn3)[C@H]([Si](C)(C)F)[C@H]1C)C(=O)N2C |
| InChI | InChI=1S/C28H35FN4O4Si/c1-18-26(38(4,5)29)25(37-28(18)22-15-20(36-3)11-12-24(22)32(2)27(28)35)13-14-33-16-23(30-31-33)21(17-34)19-9-7-6-8-10-19/h6-12,15-16,18,21,25-26,34H,13-14,17H2,1-5H3/t18-,21?,25+,26-,28+/m1/s1 |
| InChIKey | BGCXNHKNLKUGLC-BHQXKIEZSA-N |
| XLogP | 4.25 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|