C40H44N4O5Si — CID 23984195
(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23984195) has the molecular formula C40H44N4O5Si and a molecular weight of 688.90 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23984195 |
| Molecular Formula | C40H44N4O5Si |
| Molecular Weight | 688.90 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCn3cc(C(CO)c4ccccc4)nn3)O[C@@]3(C(=O)N(c4ccccc4)c4ccc(OC)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C40H44N4O5Si/c1-27-38(50(4,5)32-19-16-30(47-2)17-20-32)37(22-23-43-25-35(41-42-43)33(26-45)28-12-8-6-9-13-28)49-40(27)34-24-31(48-3)18-21-36(34)44(39(40)46)29-14-10-7-11-15-29/h6-21,24-25,27,33,37-38,45H,22-23,26H2,1-5H3/t27-,33?,37+,38-,40+/m1/s1 |
| InChIKey | BDKQRQRDMNOGKP-ZGOGXVQTSA-N |
| XLogP | 6.40 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.90 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|