C35H37FN6O4Si — CID 23757449
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23757449) has the molecular formula C35H37FN6O4Si and a molecular weight of 652.80 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23757449 |
| Molecular Formula | C35H37FN6O4Si |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@]12C(=O)N(C)c1ccc(-n3ncc4ccccc4c3=O)cc12 |
| InChI | InChI=1S/C35H37FN6O4Si/c1-22-32(47(3,4)36)31(16-17-41-20-29(38-39-41)27(21-43)23-10-6-5-7-11-23)46-35(22)28-18-25(14-15-30(28)40(2)34(35)45)42-33(44)26-13-9-8-12-24(26)19-37-42/h5-15,18-20,22,27,31-32,43H,16-17,21H2,1-4H3/t22-,27?,31+,32-,35+/m0/s1 |
| InChIKey | VGDNAJUJHLAPCN-VYNWVXRRSA-N |
| XLogP | 4.94 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|