C31H39FN6O4Si — CID 23983923
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23983923) has the molecular formula C31H39FN6O4Si and a molecular weight of 606.78 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23983923 |
| Molecular Formula | C31H39FN6O4Si |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@]12C(=O)N(C)c1ccc(N3CCNCC3=O)cc12 |
| InChI | InChI=1S/C31H39FN6O4Si/c1-20-29(43(3,4)32)27(12-14-37-18-25(34-35-37)23(19-39)21-8-6-5-7-9-21)42-31(20)24-16-22(38-15-13-33-17-28(38)40)10-11-26(24)36(2)30(31)41/h5-11,16,18,20,23,27,29,33,39H,12-15,17,19H2,1-4H3/t20-,23?,27+,29-,31+/m0/s1 |
| InChIKey | BBDBPXAXOVOIFG-JWOPCUENSA-N |
| XLogP | 3.18 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|