C31H38FN5O4Si — CID 23787110
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23787110) has the molecular formula C31H38FN5O4Si and a molecular weight of 591.76 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23787110 |
| Molecular Formula | C31H38FN5O4Si |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@@]12C(=O)Nc1ccc(N3CCCCC3=O)cc12 |
| InChI | InChI=1S/C31H38FN5O4Si/c1-20-29(42(2,3)32)27(14-16-36-18-26(34-35-36)23(19-38)21-9-5-4-6-10-21)41-31(20)24-17-22(12-13-25(24)33-30(31)40)37-15-8-7-11-28(37)39/h4-6,9-10,12-13,17-18,20,23,27,29,38H,7-8,11,14-16,19H2,1-3H3,(H,33,40)/t20-,23?,27+,29-,31+/m1/s1 |
| InChIKey | UTWLLGORVZLEEF-NIXMTNLUSA-N |
| XLogP | 4.74 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|