C25H35N5O5Si — CID 23984179
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23984179) has the molecular formula C25H35N5O5Si and a molecular weight of 513.67 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23984179 |
| Molecular Formula | C25H35N5O5Si |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)Nc1ccc(N3CCCCC3=O)cc12 |
| InChI | InChI=1S/C25H35N5O5Si/c1-16-23(36(2,3)34)21(9-12-29-15-17(10-13-31)27-28-29)35-25(16)19-14-18(7-8-20(19)26-24(25)33)30-11-5-4-6-22(30)32/h7-8,14-16,21,23,31,34H,4-6,9-13H2,1-3H3,(H,26,33)/t16-,21+,23-,25+/m1/s1 |
| InChIKey | HTNGNTOAKZJHBE-CDLPRMAYSA-N |
| XLogP | 2.17 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|