C31H39N5O5Si — CID 23815594
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23815594) has the molecular formula C31H39N5O5Si and a molecular weight of 589.77 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23815594 |
| Molecular Formula | C31H39N5O5Si |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperidin-1-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCn2cc(CCO)nn2)O[C@]12C(=O)N(c1ccccc1)c1ccc(N3CCCCC3=O)cc12 |
| InChI | InChI=1S/C31H39N5O5Si/c1-21-29(42(2,3)40)27(14-17-34-20-22(15-18-37)32-33-34)41-31(21)25-19-24(35-16-8-7-11-28(35)38)12-13-26(25)36(30(31)39)23-9-5-4-6-10-23/h4-6,9-10,12-13,19-21,27,29,37,40H,7-8,11,14-18H2,1-3H3/t21-,27+,29-,31+/m0/s1 |
| InChIKey | DCUDBNFFUOHPRO-NDPSPKMNSA-N |
| XLogP | 3.90 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|