C24H32FN5O4Si — CID 23900546
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxoazetidin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23900546) has the molecular formula C24H32FN5O4Si and a molecular weight of 501.64 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxoazetidin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxoazetidin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23900546 |
| Molecular Formula | C24H32FN5O4Si |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxoazetidin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(C)c1ccc(N3CCC3=O)cc12 |
| InChI | InChI=1S/C24H32FN5O4Si/c1-15-22(35(3,4)25)20(7-10-29-14-16(9-12-31)26-27-29)34-24(15)18-13-17(30-11-8-21(30)32)5-6-19(18)28(2)23(24)33/h5-6,13-15,20,22,31H,7-12H2,1-4H3/t15-,20+,22-,24+/m1/s1 |
| InChIKey | OTXMTCWYZMKOEP-JSHYKCHHSA-N |
| XLogP | 2.39 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|