C29H33FN6O4Si — CID 23984170
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23984170) has the molecular formula C29H33FN6O4Si and a molecular weight of 576.71 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23984170 |
| Molecular Formula | C29H33FN6O4Si |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(C)c1ccc(-n3ncc4ccccc4c3=O)cc12 |
| InChI | InChI=1S/C29H33FN6O4Si/c1-18-26(41(3,4)30)25(11-13-35-17-20(12-14-37)32-33-35)40-29(18)23-15-21(9-10-24(23)34(2)28(29)39)36-27(38)22-8-6-5-7-19(22)16-31-36/h5-10,15-18,25-26,37H,11-14H2,1-4H3/t18-,25+,26-,29+/m1/s1 |
| InChIKey | IBMUZBPFPFWDKH-OYZQDGOESA-N |
| XLogP | 3.35 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|