C30H35FN6O4Si — CID 23900261
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1H-indazol-2-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23900261) has the molecular formula C30H35FN6O4Si and a molecular weight of 590.73 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1H-indazol-2-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1H-indazol-2-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23900261 |
| Molecular Formula | C30H35FN6O4Si |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1H-indazol-2-yl)-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C=CCN1C(=O)[C@]2(O[C@H](CCn3cc(CCO)nn3)[C@@H]([Si](C)(C)F)[C@@H]2C)c2cc(-n3[nH]c4ccccc4c3=O)ccc21 |
| InChI | InChI=1S/C30H35FN6O4Si/c1-5-14-36-25-11-10-21(37-28(39)22-8-6-7-9-24(22)33-37)17-23(25)30(29(36)40)19(2)27(42(3,4)31)26(41-30)12-15-35-18-20(13-16-38)32-34-35/h5-11,17-19,26-27,33,38H,1,12-16H2,2-4H3/t19-,26+,27-,30+/m0/s1 |
| InChIKey | RHVITHIEHUJIES-JDBDPAOTSA-N |
| XLogP | 3.84 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|