C28H36FN5O6Si — CID 23757427
[1-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate (PubChem CID 23757427) has the molecular formula C28H36FN5O6Si and a molecular weight of 585.71 g/mol. Its IUPAC name is [1-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 23757427 |
| Molecular Formula | C28H36FN5O6Si |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | [1-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate |
| SMILES | C=CCN1C(=O)[C@]2(O[C@H](CCn3cc(CCO)nn3)[C@@H]([Si](C)(C)F)[C@@H]2C)c2cc(N3C(=O)CC3OC(C)=O)ccc21 |
| InChI | InChI=1S/C28H36FN5O6Si/c1-6-11-33-22-8-7-20(34-24(37)15-25(34)39-18(3)36)14-21(22)28(27(33)38)17(2)26(41(4,5)29)23(40-28)9-12-32-16-19(10-13-35)30-31-32/h6-8,14,16-17,23,25-26,35H,1,9-13,15H2,2-5H3/t17-,23+,25?,26-,28+/m0/s1 |
| InChIKey | DBAZBPAEYADFDC-MZBOILIPSA-N |
| XLogP | 2.84 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|