C31H36FN5O6Si — CID 23872627
[1-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate (PubChem CID 23872627) has the molecular formula C31H36FN5O6Si and a molecular weight of 621.74 g/mol. Its IUPAC name is [1-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 23872627 |
| Molecular Formula | C31H36FN5O6Si |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | [1-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)N1c1ccc2c(c1)[C@]1(O[C@@H](CCn3cc(CCO)nn3)[C@H]([Si](C)(C)F)[C@H]1C)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C31H36FN5O6Si/c1-19-29(44(3,4)32)26(12-14-35-18-21(13-15-38)33-34-35)43-31(19)24-16-23(37-27(40)17-28(37)42-20(2)39)10-11-25(24)36(30(31)41)22-8-6-5-7-9-22/h5-11,16,18-19,26,28-29,38H,12-15,17H2,1-4H3/t19-,26+,28?,29-,31+/m1/s1 |
| InChIKey | FTALTPLDRMKRJV-LGICCWPZSA-N |
| XLogP | 3.98 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|