C29H35N5O6Si — CID 23787055
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23787055) has the molecular formula C29H35N5O6Si and a molecular weight of 577.71 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23787055 |
| Molecular Formula | C29H35N5O6Si |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(c1ccccc1)c1ccc(N3CCOC3=O)cc12 |
| InChI | InChI=1S/C29H35N5O6Si/c1-19-26(41(2,3)38)25(11-13-32-18-20(12-15-35)30-31-32)40-29(19)23-17-22(33-14-16-39-28(33)37)9-10-24(23)34(27(29)36)21-7-5-4-6-8-21/h4-10,17-19,25-26,35,38H,11-16H2,1-3H3/t19-,25+,26-,29+/m1/s1 |
| InChIKey | ZECLNMDUHLTYPE-MDVIVPNSSA-N |
| XLogP | 3.34 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|