C31H40N6O5Si — CID 23985373
(3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23985373) has the molecular formula C31H40N6O5Si and a molecular weight of 604.78 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23985373 |
| Molecular Formula | C31H40N6O5Si |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(Cc1ccccc1)c1ccc(N3CCNCC3=O)cc12 |
| InChI | InChI=1S/C31H40N6O5Si/c1-21-29(43(2,3)41)27(11-14-35-20-23(12-16-38)33-34-35)42-31(21)25-17-24(36-15-13-32-18-28(36)39)9-10-26(25)37(30(31)40)19-22-7-5-4-6-8-22/h4-10,17,20-21,27,29,32,38,41H,11-16,18-19H2,1-3H3/t21-,27+,29-,31+/m1/s1 |
| InChIKey | YEQQOXPSCKJPKT-NFZXEAEESA-N |
| XLogP | 2.18 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|