C35H38FN5O5Si — CID 23815799
(3S,3'S,4'R,5'S)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23815799) has the molecular formula C35H38FN5O5Si and a molecular weight of 655.80 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23815799 |
| Molecular Formula | C35H38FN5O5Si |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | (3S,3'S,4'R,5'S)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(Cc1ccccc1)c1ccc(N3C(=O)COc4ccccc43)cc12 |
| InChI | InChI=1S/C35H38FN5O5Si/c1-23-33(47(2,3)36)31(15-17-39-21-25(16-18-42)37-38-39)46-35(23)27-19-26(41-29-11-7-8-12-30(29)45-22-32(41)43)13-14-28(27)40(34(35)44)20-24-9-5-4-6-10-24/h4-14,19,21,23,31,33,42H,15-18,20,22H2,1-3H3/t23-,31+,33-,35+/m1/s1 |
| InChIKey | IKFGLHNCVZRLEO-FECIINAGSA-N |
| XLogP | 5.28 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|