C34H38FN5O4Si — CID 23929701
N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide (PubChem CID 23929701) has the molecular formula C34H38FN5O4Si and a molecular weight of 627.79 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide |
|---|---|
| PubChem CID | 23929701 |
| Molecular Formula | C34H38FN5O4Si |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(CCO)nn2)O[C@]12C(=O)N(Cc1ccccc1)c1ccc(N(C=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C34H38FN5O4Si/c1-24-32(45(2,3)35)31(16-18-38-22-26(17-19-41)36-37-38)44-34(24)29-20-28(40(23-42)27-12-8-5-9-13-27)14-15-30(29)39(33(34)43)21-25-10-6-4-7-11-25/h4-15,20,22-24,31-32,41H,16-19,21H2,1-3H3/t24-,31+,32-,34+/m0/s1 |
| InChIKey | LHCIOOYVNMDMGA-ZKASZLECSA-N |
| XLogP | 5.52 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|