C25H29FN2O5Si — CID 23928555
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23928555) has the molecular formula C25H29FN2O5Si and a molecular weight of 484.60 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23928555 |
| Molecular Formula | C25H29FN2O5Si |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCO)O[C@@]12C(=O)N(c1ccccc1)c1ccc(N3CCOC3=O)cc12 |
| InChI | InChI=1S/C25H29FN2O5Si/c1-16-22(34(2,3)26)21(11-13-29)33-25(16)19-15-18(27-12-14-32-24(27)31)9-10-20(19)28(23(25)30)17-7-5-4-6-8-17/h4-10,15-16,21-22,29H,11-14H2,1-3H3/t16-,21+,22-,25+/m1/s1 |
| InChIKey | FKRXEHGCESSBRV-MZBWQFGNSA-N |
| XLogP | 4.48 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|