C26H31BrN2O6Si — CID 23759188
(3S,3'S,4'R,5'S)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23759188) has the molecular formula C26H31BrN2O6Si and a molecular weight of 575.53 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23759188 |
| Molecular Formula | C26H31BrN2O6Si |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5-bromo-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCO)O[C@@]12C(=O)N(Cc1cccc(N3CCOC3=O)c1)c1ccc(Br)cc12 |
| InChI | InChI=1S/C26H31BrN2O6Si/c1-16-23(36(2,3)33)22(9-11-30)35-26(16)20-14-18(27)7-8-21(20)29(24(26)31)15-17-5-4-6-19(13-17)28-10-12-34-25(28)32/h4-8,13-14,16,22-23,30,33H,9-12,15H2,1-3H3/t16-,22+,23-,26+/m1/s1 |
| InChIKey | MFQZOCPDTNDNOG-AZTGYOCHSA-N |
| XLogP | 4.13 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|