C27H34N2O7Si — CID 23929442
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23929442) has the molecular formula C27H34N2O7Si and a molecular weight of 526.66 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23929442 |
| Molecular Formula | C27H34N2O7Si |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc2c(c1)[C@]1(O[C@@H](CCO)[C@H]([Si](C)(C)O)[C@H]1C)C(=O)N2Cc1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C27H34N2O7Si/c1-17-24(37(3,4)33)23(11-13-30)36-27(17)21-15-20(34-2)9-10-22(21)29(25(27)31)16-18-5-7-19(8-6-18)28-12-14-35-26(28)32/h5-10,15,17,23-24,30,33H,11-14,16H2,1-4H3/t17-,23+,24-,27+/m1/s1 |
| InChIKey | KNXRDWYJFPOLRB-XGBYBTARSA-N |
| XLogP | 3.38 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|