C30H36N2O7Si — CID 23758834
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23758834) has the molecular formula C30H36N2O7Si and a molecular weight of 564.71 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23758834 |
| Molecular Formula | C30H36N2O7Si |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc2c(c1)[C@@]1(O[C@H](CCO)[C@@H]([Si](C)(C)O)[C@@H]1C)C(=O)N2Cc1cccc(-n2cccc(OC)c2=O)c1 |
| InChI | InChI=1S/C30H36N2O7Si/c1-19-27(40(4,5)36)25(13-15-33)39-30(19)23-17-22(37-2)11-12-24(23)32(29(30)35)18-20-8-6-9-21(16-20)31-14-7-10-26(38-3)28(31)34/h6-12,14,16-17,19,25,27,33,36H,13,15,18H2,1-5H3/t19-,25+,27-,30+/m0/s1 |
| InChIKey | MXIHQUFUQKBSCJ-MBMRHNPUSA-N |
| XLogP | 3.58 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|