C31H36N2O6Si — CID 23929172
N-[3-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide (PubChem CID 23929172) has the molecular formula C31H36N2O6Si and a molecular weight of 560.72 g/mol. Its IUPAC name is N-[3-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide.
| Compound Name | N-[3-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23929172 |
| Molecular Formula | C31H36N2O6Si |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | N-[3-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
| SMILES | COc1ccc2c(c1)[C@@]1(O[C@H](CCO)[C@@H]([Si](C)(C)O)[C@@H]1C)C(=O)N2Cc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H36N2O6Si/c1-20-28(40(3,4)37)27(15-16-34)39-31(20)25-18-24(38-2)13-14-26(25)33(30(31)36)19-21-9-8-12-23(17-21)32-29(35)22-10-6-5-7-11-22/h5-14,17-18,20,27-28,34,37H,15-16,19H2,1-4H3,(H,32,35)/t20-,27+,28-,31+/m0/s1 |
| InChIKey | ZIXLTIJXXVGQSA-CHEPEEJRSA-N |
| XLogP | 4.67 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|