C37H41N3O5Si — CID 23985364
4-amino-N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23985364) has the molecular formula C37H41N3O5Si and a molecular weight of 635.84 g/mol. Its IUPAC name is 4-amino-N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | 4-amino-N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23985364 |
| Molecular Formula | C37H41N3O5Si |
| Molecular Weight | 635.84 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | 4-amino-N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(Cc4ccccc4)c4ccc(NC(=O)c5ccc(N)cc5)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C37H41N3O5Si/c1-24-34(46(3,4)30-17-15-29(44-2)16-18-30)33(20-21-41)45-37(24)31-22-28(39-35(42)26-10-12-27(38)13-11-26)14-19-32(31)40(36(37)43)23-25-8-6-5-7-9-25/h5-19,22,24,33-34,41H,20-21,23,38H2,1-4H3,(H,39,42)/t24-,33+,34-,37+/m1/s1 |
| InChIKey | CXIASOUZLMNCCU-IDVJDEGWSA-N |
| XLogP | 5.67 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.84 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|