C39H44N2O7Si — CID 23816954
N-[4-[[(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide (PubChem CID 23816954) has the molecular formula C39H44N2O7Si and a molecular weight of 680.87 g/mol. Its IUPAC name is N-[4-[[(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[[(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23816954 |
| Molecular Formula | C39H44N2O7Si |
| Molecular Weight | 680.87 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | N-[4-[[(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(CN3C(=O)[C@@]4(O[C@@H](CCO)[C@H]([Si](C)(C)c5ccc(OC)cc5)[C@H]4C)c4cc(OC)ccc43)cc2)cc1 |
| InChI | InChI=1S/C39H44N2O7Si/c1-25-36(49(5,6)32-18-15-30(46-3)16-19-32)35(21-22-42)48-39(25)33-23-31(47-4)17-20-34(33)41(38(39)44)24-26-7-11-28(12-8-26)40-37(43)27-9-13-29(45-2)14-10-27/h7-20,23,25,35-36,42H,21-22,24H2,1-6H3,(H,40,43)/t25-,35+,36-,39+/m1/s1 |
| InChIKey | VTOKOIYHPQRQBV-ZTTVOOIJSA-N |
| XLogP | 6.11 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.87 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|