C38H43N3O6Si — CID 23873170
4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide (PubChem CID 23873170) has the molecular formula C38H43N3O6Si and a molecular weight of 665.86 g/mol. Its IUPAC name is 4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23873170 |
| Molecular Formula | C38H43N3O6Si |
| Molecular Weight | 665.86 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-5-methoxy-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(Cc4cccc(NC(=O)c5ccc(N)cc5)c4)c4ccc(OC)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C38H43N3O6Si/c1-24-35(48(4,5)31-16-13-29(45-2)14-17-31)34(19-20-42)47-38(24)32-22-30(46-3)15-18-33(32)41(37(38)44)23-25-7-6-8-28(21-25)40-36(43)26-9-11-27(39)12-10-26/h6-18,21-22,24,34-35,42H,19-20,23,39H2,1-5H3,(H,40,43)/t24-,34+,35-,38+/m0/s1 |
| InChIKey | UUMAHQNEGIOQQA-SXSJRGLMSA-N |
| XLogP | 5.68 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|