C38H41ClN2O6Si — CID 23758546
N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide (PubChem CID 23758546) has the molecular formula C38H41ClN2O6Si and a molecular weight of 685.29 g/mol. Its IUPAC name is N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23758546 |
| Molecular Formula | C38H41ClN2O6Si |
| Molecular Weight | 685.29 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(CN3C(=O)[C@]4(O[C@H](CCO)[C@@H]([Si](C)(C)c5ccc(OC)cc5)[C@@H]4C)c4cc(Cl)ccc43)c2)cc1 |
| InChI | InChI=1S/C38H41ClN2O6Si/c1-24-35(48(4,5)31-16-14-30(46-3)15-17-31)34(19-20-42)47-38(24)32-22-27(39)11-18-33(32)41(37(38)44)23-25-7-6-8-28(21-25)40-36(43)26-9-12-29(45-2)13-10-26/h6-18,21-22,24,34-35,42H,19-20,23H2,1-5H3,(H,40,43)/t24-,34+,35-,38+/m0/s1 |
| InChIKey | GWFQCLZTNPMTEG-SXSJRGLMSA-N |
| XLogP | 6.75 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.29 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|