C32H38N2O7Si — CID 23901450
N-[3-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide (PubChem CID 23901450) has the molecular formula C32H38N2O7Si and a molecular weight of 590.75 g/mol. Its IUPAC name is N-[3-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23901450 |
| Molecular Formula | C32H38N2O7Si |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N-[3-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(CN3C(=O)[C@@]4(O[C@@H](CCO)[C@H]([Si](C)(C)O)[C@H]4C)c4cc(OC)ccc43)c2)cc1 |
| InChI | InChI=1S/C32H38N2O7Si/c1-20-29(42(4,5)38)28(15-16-35)41-32(20)26-18-25(40-3)13-14-27(26)34(31(32)37)19-21-7-6-8-23(17-21)33-30(36)22-9-11-24(39-2)12-10-22/h6-14,17-18,20,28-29,35,38H,15-16,19H2,1-5H3,(H,33,36)/t20-,28+,29-,32+/m1/s1 |
| InChIKey | JKYBIDQYFXLFQG-AFVUSQPTSA-N |
| XLogP | 4.68 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|